C20H22N4O — CID 111316022
2-[(4-cyanophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-ethylguanidine (PubChem CID 111316022) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-ethylguanidine.
| Compound Name | 2-[(4-cyanophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-ethylguanidine |
|---|---|
| PubChem CID | 111316022 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 2-[(4-cyanophenyl)methyl]-1-(3,4-dihydro-2H-chromen-4-yl)-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(C#N)cc1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C20H22N4O/c1-2-22-20(23-14-16-9-7-15(13-21)8-10-16)24-18-11-12-25-19-6-4-3-5-17(18)19/h3-10,18H,2,11-12,14H2,1H3,(H2,22,23,24) |
| InChIKey | FKIWKSZTPHVOPF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|