C20H24N4O3 — CID 111542166
1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4-nitrophenyl)methyl]-3-propan-2-ylguanidine (PubChem CID 111542166) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4-nitrophenyl)methyl]-3-propan-2-ylguanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4-nitrophenyl)methyl]-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 111542166 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(4-nitrophenyl)methyl]-3-propan-2-ylguanidine |
| SMILES | CC(C)N/C(=N\Cc1ccc([N+](=O)[O-])cc1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C20H24N4O3/c1-14(2)22-20(21-13-15-7-9-16(10-8-15)24(25)26)23-18-11-12-27-19-6-4-3-5-17(18)19/h3-10,14,18H,11-13H2,1-2H3,(H2,21,22,23) |
| InChIKey | NWVTZNWEHLBPOH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|