C21H25IN4O3 — CID 111316143
1-(3,4-dihydro-2H-chromen-4-yl)-3-(2-methylprop-2-enyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide (PubChem CID 111316143) has the molecular formula C21H25IN4O3 and a molecular weight of 508.36 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-3-(2-methylprop-2-enyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-(2-methylprop-2-enyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111316143 |
| Molecular Formula | C21H25IN4O3 |
| Molecular Weight | 508.36 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-(2-methylprop-2-enyl)-2-[(4-nitrophenyl)methyl]guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(=N\Cc1ccc([N+](=O)[O-])cc1)NC1CCOc2ccccc21.I |
| InChI | InChI=1S/C21H24N4O3.HI/c1-15(2)13-22-21(23-14-16-7-9-17(10-8-16)25(26)27)24-19-11-12-28-20-6-4-3-5-18(19)20;/h3-10,19H,1,11-14H2,2H3,(H2,22,23,24);1H |
| InChIKey | YEBSOMZPSFESOQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|