C18H27IN4O2 — CID 111765654
1-(2-bicyclo[2.2.1]heptanyl)-2-[(4-nitrophenyl)methyl]-3-propan-2-ylguanidine;hydroiodide (PubChem CID 111765654) has the molecular formula C18H27IN4O2 and a molecular weight of 458.34 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2-[(4-nitrophenyl)methyl]-3-propan-2-ylguanidine;hydroiodide.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-[(4-nitrophenyl)methyl]-3-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111765654 |
| Molecular Formula | C18H27IN4O2 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-[(4-nitrophenyl)methyl]-3-propan-2-ylguanidine;hydroiodide |
| SMILES | CC(C)N/C(=N\Cc1ccc([N+](=O)[O-])cc1)NC1CC2CCC1C2.I |
| InChI | InChI=1S/C18H26N4O2.HI/c1-12(2)20-18(21-17-10-14-3-6-15(17)9-14)19-11-13-4-7-16(8-5-13)22(23)24;/h4-5,7-8,12,14-15,17H,3,6,9-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | KBMDNTPPNLLUML-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|