C14H16N2O3 — CID 11630293
N-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-4-nitrobenzamide (PubChem CID 11630293) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is N-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-4-nitrobenzamide.
| Compound Name | N-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 11630293 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | N-[(1S,4R)-2-bicyclo[2.2.1]heptanyl]-4-nitrobenzamide |
| SMILES | O=C(NC1C[C@@H]2CC[C@H]1C2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H16N2O3/c17-14(10-3-5-12(6-4-10)16(18)19)15-13-8-9-1-2-11(13)7-9/h3-6,9,11,13H,1-2,7-8H2,(H,15,17)/t9-,11+,13?/m1/s1 |
| InChIKey | FIAPPNUXSAQKTO-PPHWZAGGSA-N |
| XLogP | 2.51 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|