C12H14N2O4 — CID 95562447
N-[(1S,2S)-2-hydroxycyclopentyl]-4-nitrobenzamide (PubChem CID 95562447) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclopentyl]-4-nitrobenzamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclopentyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 95562447 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclopentyl]-4-nitrobenzamide |
| SMILES | O=C(N[C@H]1CCC[C@@H]1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14N2O4/c15-11-3-1-2-10(11)13-12(16)8-4-6-9(7-5-8)14(17)18/h4-7,10-11,15H,1-3H2,(H,13,16)/t10-,11-/m0/s1 |
| InChIKey | AURNBJUNLCGYMJ-QWRGUYRKSA-N |
| XLogP | 1.24 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|