C14H17N5O3 — CID 102037484
N-[(1R,2R)-2-azidocycloheptyl]-4-nitrobenzamide (PubChem CID 102037484) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-[(1R,2R)-2-azidocycloheptyl]-4-nitrobenzamide.
| Compound Name | N-[(1R,2R)-2-azidocycloheptyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 102037484 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[(1R,2R)-2-azidocycloheptyl]-4-nitrobenzamide |
| SMILES | [N-]=[N+]=N[C@@H]1CCCCC[C@H]1NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H17N5O3/c15-18-17-13-5-3-1-2-4-12(13)16-14(20)10-6-8-11(9-7-10)19(21)22/h6-9,12-13H,1-5H2,(H,16,20)/t12-,13-/m1/s1 |
| InChIKey | ZVLLQODHBPCVHB-CHWSQXEVSA-N |
| XLogP | 3.34 |
| TPSA | 121.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|