C14H16N4O3 — CID 167806664
3-[[(1R,2S)-2-azidocyclopentyl]carbamoyl]-4-methylbenzoic acid (PubChem CID 167806664) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-[[(1R,2S)-2-azidocyclopentyl]carbamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[[(1R,2S)-2-azidocyclopentyl]carbamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 167806664 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-[[(1R,2S)-2-azidocyclopentyl]carbamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C(=O)N[C@@H]1CCC[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H16N4O3/c1-8-5-6-9(14(20)21)7-10(8)13(19)16-11-3-2-4-12(11)17-18-15/h5-7,11-12H,2-4H2,1H3,(H,16,19)(H,20,21)/t11-,12+/m1/s1 |
| InChIKey | SUKOPVSJKATELR-NEPJUHHUSA-N |
| XLogP | 2.65 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|