C15H20O4 — CID 174566305
cyclohexane;4-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174566305) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is cyclohexane;4-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | cyclohexane;4-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174566305 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | cyclohexane;4-methylbenzene-1,3-dicarboxylic acid |
| SMILES | C1CCCCC1.Cc1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C6H12/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;1-2-4-6-5-3-1/h2-4H,1H3,(H,10,11)(H,12,13);1-6H2 |
| InChIKey | OIMVGKRDTKMEGO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |