C14H18N2O5 — CID 174755886
4-methylbenzene-1,3-dicarboxylic acid;piperazine-1-carbaldehyde (PubChem CID 174755886) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-methylbenzene-1,3-dicarboxylic acid;piperazine-1-carbaldehyde.
| Compound Name | 4-methylbenzene-1,3-dicarboxylic acid;piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 174755886 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 4-methylbenzene-1,3-dicarboxylic acid;piperazine-1-carbaldehyde |
| SMILES | Cc1ccc(C(=O)O)cc1C(=O)O.O=CN1CCNCC1 |
| InChI | InChI=1S/C9H8O4.C5H10N2O/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;8-5-7-3-1-6-2-4-7/h2-4H,1H3,(H,10,11)(H,12,13);5-6H,1-4H2 |
| InChIKey | NGEBNFRVKZECJL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|