C11H10O6 — CID 174429054
4-methylbenzene-1,3-dicarboxylic acid;oxaldehyde (PubChem CID 174429054) has the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. Its IUPAC name is 4-methylbenzene-1,3-dicarboxylic acid;oxaldehyde.
| Compound Name | 4-methylbenzene-1,3-dicarboxylic acid;oxaldehyde |
|---|---|
| PubChem CID | 174429054 |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-methylbenzene-1,3-dicarboxylic acid;oxaldehyde |
| SMILES | Cc1ccc(C(=O)O)cc1C(=O)O.O=CC=O |
| InChI | InChI=1S/C9H8O4.C2H2O2/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;3-1-2-4/h2-4H,1H3,(H,10,11)(H,12,13);1-2H |
| InChIKey | ODZQZCXHZFLIMU-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|