About 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide
4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide (PubChem CID 174681004) has the molecular formula C15H22O7S2
and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide |
| PubChem CID | 174681004 |
| Molecular Formula | C15H22O7S2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide |
| SMILES | CS(C)=O.Cc1ccc(C(=O)O)cc1C(=O)O.O=S1(=O)CCCC1 |
| InChI | InChI=1S/C9H8O4.C4H8O2S.C2H6OS/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;5-7(6)3-1-2-4-7;1-4(2)3/h2-4H,1H3,(H,10,11)(H,12,13);1-4H2;1-2H3 |
| InChIKey | NYGHZWJCLPVCQQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide?
The IUPAC name of 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide (CID 174681004) is 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide.
What is the SMILES notation for 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide?
The canonical SMILES for 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide is CS(C)=O.Cc1ccc(C(=O)O)cc1C(=O)O.O=S1(=O)CCCC1.
What is the InChIKey of 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide?
The InChIKey is NYGHZWJCLPVCQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.C4H8O2S.C2H6OS/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;5-7(6)3-1-2-4-7;1-4(2)3/h2-4H,1H3,(H,10,11)(H,12,13);1-4H2;1-2H3.
What are the key properties of 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide?
4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide has a molecular weight of 378.47 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzene-1,3-dicarboxylic acid;methylsulfinylmethane;thiolane 1,1-dioxide is sourced from PubChem (CID 174681004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).