C20H24O6 — CID 162245848
4-methylbenzene-1,3-dicarboxylic acid;1-phenylpentane-2,3-diol (PubChem CID 162245848) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-methylbenzene-1,3-dicarboxylic acid;1-phenylpentane-2,3-diol.
| Compound Name | 4-methylbenzene-1,3-dicarboxylic acid;1-phenylpentane-2,3-diol |
|---|---|
| PubChem CID | 162245848 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-methylbenzene-1,3-dicarboxylic acid;1-phenylpentane-2,3-diol |
| SMILES | CCC(O)C(O)Cc1ccccc1.Cc1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C11H16O2.C9H8O4/c1-2-10(12)11(13)8-9-6-4-3-5-7-9;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h3-7,10-13H,2,8H2,1H3;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | ZXHYHMNITZKAOP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |