C17H16O5 — CID 174537514
4-methylbenzene-1,3-dicarboxylic acid;1-phenylethanone (PubChem CID 174537514) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 4-methylbenzene-1,3-dicarboxylic acid;1-phenylethanone.
| Compound Name | 4-methylbenzene-1,3-dicarboxylic acid;1-phenylethanone |
|---|---|
| PubChem CID | 174537514 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-methylbenzene-1,3-dicarboxylic acid;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.Cc1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C8H8O/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;1-7(9)8-5-3-2-4-6-8/h2-4H,1H3,(H,10,11)(H,12,13);2-6H,1H3 |
| InChIKey | YJGWWTCLPIGHBH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |