C14H18O4 — CID 158765893
4-methylbenzene-1,3-dicarboxylic acid;pent-1-ene (PubChem CID 158765893) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 4-methylbenzene-1,3-dicarboxylic acid;pent-1-ene.
| Compound Name | 4-methylbenzene-1,3-dicarboxylic acid;pent-1-ene |
|---|---|
| PubChem CID | 158765893 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-methylbenzene-1,3-dicarboxylic acid;pent-1-ene |
| SMILES | C=CCCC.Cc1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C5H10/c1-5-2-3-6(8(10)11)4-7(5)9(12)13;1-3-5-4-2/h2-4H,1H3,(H,10,11)(H,12,13);3H,1,4-5H2,2H3 |
| InChIKey | IPGGNKCETVAXAF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|