C21H34O5 — CID 174463462
4-methylbenzene-1,3-dicarboxylic acid;2-propylnonan-1-ol (PubChem CID 174463462) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 4-methylbenzene-1,3-dicarboxylic acid;2-propylnonan-1-ol.
| Compound Name | 4-methylbenzene-1,3-dicarboxylic acid;2-propylnonan-1-ol |
|---|---|
| PubChem CID | 174463462 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-methylbenzene-1,3-dicarboxylic acid;2-propylnonan-1-ol |
| SMILES | CCCCCCCC(CO)CCC.Cc1ccc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C12H26O.C9H8O4/c1-3-5-6-7-8-10-12(11-13)9-4-2;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h12-13H,3-11H2,1-2H3;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | SMRQYSXMSJIKQY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|