C26H46O6 — CID 175572575
furan-2,3-dicarboxylic acid;2-octyldodecan-1-ol (PubChem CID 175572575) has the molecular formula C26H46O6 and a molecular weight of 454.65 g/mol. Its IUPAC name is furan-2,3-dicarboxylic acid;2-octyldodecan-1-ol.
| Compound Name | furan-2,3-dicarboxylic acid;2-octyldodecan-1-ol |
|---|---|
| PubChem CID | 175572575 |
| Molecular Formula | C26H46O6 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | furan-2,3-dicarboxylic acid;2-octyldodecan-1-ol |
| SMILES | CCCCCCCCCCC(CO)CCCCCCCC.O=C(O)c1ccoc1C(=O)O |
| InChI | InChI=1S/C20H42O.C6H4O5/c1-3-5-7-9-11-12-14-16-18-20(19-21)17-15-13-10-8-6-4-2;7-5(8)3-1-2-11-4(3)6(9)10/h20-21H,3-19H2,1-2H3;1-2H,(H,7,8)(H,9,10) |
| InChIKey | LWWMBFLSGOAAHA-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|