C20H17NO7S — CID 174450720
1-(benzenesulfonyl)pyrrole-2-carbaldehyde;4-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174450720) has the molecular formula C20H17NO7S and a molecular weight of 415.42 g/mol. Its IUPAC name is 1-(benzenesulfonyl)pyrrole-2-carbaldehyde;4-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 1-(benzenesulfonyl)pyrrole-2-carbaldehyde;4-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174450720 |
| Molecular Formula | C20H17NO7S |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 1-(benzenesulfonyl)pyrrole-2-carbaldehyde;4-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C(=O)O.O=Cc1cccn1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H9NO3S.C9H8O4/c13-9-10-5-4-8-12(10)16(14,15)11-6-2-1-3-7-11;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h1-9H;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | SXHHVBHYDDMRBM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|