C11H9NO4S — CID 83653929
1-(benzenesulfonyl)pyrrole-2-carboxylic acid (PubChem CID 83653929) has the molecular formula C11H9NO4S and a molecular weight of 251.26 g/mol. Its IUPAC name is 1-(benzenesulfonyl)pyrrole-2-carboxylic acid.
| Compound Name | 1-(benzenesulfonyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 83653929 |
| Molecular Formula | C11H9NO4S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 1-(benzenesulfonyl)pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cccn1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H9NO4S/c13-11(14)10-7-4-8-12(10)17(15,16)9-5-2-1-3-6-9/h1-8H,(H,13,14) |
| InChIKey | ZHDFQVPZWKUCLL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |