C27H23ClN4O5S — CID 10951766
1-[3-chloro-4-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]phenyl]sulfonylpyrrole-2-carboxylic acid (PubChem CID 10951766) has the molecular formula C27H23ClN4O5S and a molecular weight of 551.02 g/mol. Its IUPAC name is 1-[3-chloro-4-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]phenyl]sulfonylpyrrole-2-carboxylic acid.
| Compound Name | 1-[3-chloro-4-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]phenyl]sulfonylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 10951766 |
| Molecular Formula | C27H23ClN4O5S |
| Molecular Weight | 551.02 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | 1-[3-chloro-4-[2-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylcarbamoyl)hydrazinyl]phenyl]sulfonylpyrrole-2-carboxylic acid |
| SMILES | O=C(NNc1ccc(S(=O)(=O)n2cccc2C(=O)O)cc1Cl)NC1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C27H23ClN4O5S/c28-22-16-19(38(36,37)32-15-5-10-24(32)26(33)34)13-14-23(22)30-31-27(35)29-25-20-8-3-1-6-17(20)11-12-18-7-2-4-9-21(18)25/h1-10,13-16,25,30H,11-12H2,(H,33,34)(H2,29,31,35) |
| InChIKey | JRMIXZHIKIVCSQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.02 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|