C17H12Cl2N2O3S — CID 70983634
1-(benzenesulfonyl)-N-(3,5-dichlorophenyl)pyrrole-2-carboxamide (PubChem CID 70983634) has the molecular formula C17H12Cl2N2O3S and a molecular weight of 395.27 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(3,5-dichlorophenyl)pyrrole-2-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(3,5-dichlorophenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 70983634 |
| Molecular Formula | C17H12Cl2N2O3S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(3,5-dichlorophenyl)pyrrole-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1cccn1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H12Cl2N2O3S/c18-12-9-13(19)11-14(10-12)20-17(22)16-7-4-8-21(16)25(23,24)15-5-2-1-3-6-15/h1-11H,(H,20,22) |
| InChIKey | ALDGIULSYWBPJT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |