C13H11Cl2N2NaO2S2 — CID 173361364
sodium;1-(benzenesulfonyl)-3-(3,5-dichlorophenyl)thiourea;hydride (PubChem CID 173361364) has the molecular formula C13H11Cl2N2NaO2S2 and a molecular weight of 385.27 g/mol. Its IUPAC name is sodium;1-(benzenesulfonyl)-3-(3,5-dichlorophenyl)thiourea;hydride.
| Compound Name | sodium;1-(benzenesulfonyl)-3-(3,5-dichlorophenyl)thiourea;hydride |
|---|---|
| PubChem CID | 173361364 |
| Molecular Formula | C13H11Cl2N2NaO2S2 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | sodium;1-(benzenesulfonyl)-3-(3,5-dichlorophenyl)thiourea;hydride |
| SMILES | O=S(=O)(NC(=S)Nc1cc(Cl)cc(Cl)c1)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C13H10Cl2N2O2S2.Na.H/c14-9-6-10(15)8-11(7-9)16-13(20)17-21(18,19)12-4-2-1-3-5-12;;/h1-8H,(H2,16,17,20);;/q;+1;-1 |
| InChIKey | HPQCXVJEHRZTSC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|