C22H23N3O4S3 — CID 118713281
1-[4-[2-[(4-methylphenyl)sulfonylamino]ethyl]phenyl]sulfonyl-3-phenylthiourea (PubChem CID 118713281) has the molecular formula C22H23N3O4S3 and a molecular weight of 489.64 g/mol. Its IUPAC name is 1-[4-[2-[(4-methylphenyl)sulfonylamino]ethyl]phenyl]sulfonyl-3-phenylthiourea.
| Compound Name | 1-[4-[2-[(4-methylphenyl)sulfonylamino]ethyl]phenyl]sulfonyl-3-phenylthiourea |
|---|---|
| PubChem CID | 118713281 |
| Molecular Formula | C22H23N3O4S3 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 1-[4-[2-[(4-methylphenyl)sulfonylamino]ethyl]phenyl]sulfonyl-3-phenylthiourea |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2ccc(S(=O)(=O)NC(=S)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O4S3/c1-17-7-11-20(12-8-17)31(26,27)23-16-15-18-9-13-21(14-10-18)32(28,29)25-22(30)24-19-5-3-2-4-6-19/h2-14,23H,15-16H2,1H3,(H2,24,25,30) |
| InChIKey | BBUUTEDYYCEGTG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|