C22H22ClN3O5S3 — CID 118713288
1-(4-chlorophenyl)-3-[4-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]phenyl]sulfonylthiourea (PubChem CID 118713288) has the molecular formula C22H22ClN3O5S3 and a molecular weight of 540.09 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[4-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]phenyl]sulfonylthiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[4-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]phenyl]sulfonylthiourea |
|---|---|
| PubChem CID | 118713288 |
| Molecular Formula | C22H22ClN3O5S3 |
| Molecular Weight | 540.09 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[4-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]phenyl]sulfonylthiourea |
| SMILES | COc1ccc(S(=O)(=O)NCCc2ccc(S(=O)(=O)NC(=S)Nc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H22ClN3O5S3/c1-31-19-8-12-20(13-9-19)33(27,28)24-15-14-16-2-10-21(11-3-16)34(29,30)26-22(32)25-18-6-4-17(23)5-7-18/h2-13,24H,14-15H2,1H3,(H2,25,26,32) |
| InChIKey | SROVVUPBCWEROF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.09 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|