C16H19N3O6S3 — CID 174393157
2-[4-[(4-methoxyphenyl)carbamothioylsulfamoyl]phenyl]ethylsulfamic acid (PubChem CID 174393157) has the molecular formula C16H19N3O6S3 and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-[4-[(4-methoxyphenyl)carbamothioylsulfamoyl]phenyl]ethylsulfamic acid.
| Compound Name | 2-[4-[(4-methoxyphenyl)carbamothioylsulfamoyl]phenyl]ethylsulfamic acid |
|---|---|
| PubChem CID | 174393157 |
| Molecular Formula | C16H19N3O6S3 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 2-[4-[(4-methoxyphenyl)carbamothioylsulfamoyl]phenyl]ethylsulfamic acid |
| SMILES | COc1ccc(NC(=S)NS(=O)(=O)c2ccc(CCNS(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H19N3O6S3/c1-25-14-6-4-13(5-7-14)18-16(26)19-27(20,21)15-8-2-12(3-9-15)10-11-17-28(22,23)24/h2-9,17H,10-11H2,1H3,(H2,18,19,26)(H,22,23,24) |
| InChIKey | UOZQHQANQSRJSQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|