C15H19N3O3S — CID 19844131
4-hydrazinyl-N-[2-(4-methoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 19844131) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-hydrazinyl-N-[2-(4-methoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 4-hydrazinyl-N-[2-(4-methoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19844131 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-hydrazinyl-N-[2-(4-methoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(CCNS(=O)(=O)c2ccc(NN)cc2)cc1 |
| InChI | InChI=1S/C15H19N3O3S/c1-21-14-6-2-12(3-7-14)10-11-17-22(19,20)15-8-4-13(18-16)5-9-15/h2-9,17-18H,10-11,16H2,1H3 |
| InChIKey | VQCXCCKUIGVZKM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|