C17H21NO5S — CID 25039968
N-[2-(3,5-dimethoxyphenyl)ethyl]-4-methoxybenzenesulfonamide (PubChem CID 25039968) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenyl)ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(3,5-dimethoxyphenyl)ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 25039968 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenyl)ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C17H21NO5S/c1-21-14-4-6-17(7-5-14)24(19,20)18-9-8-13-10-15(22-2)12-16(11-13)23-3/h4-7,10-12,18H,8-9H2,1-3H3 |
| InChIKey | QWYYGOZJFITPSZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |