C18H23NO4S — CID 110788857
N-[2-(4-ethoxy-3-methylphenyl)ethyl]-4-methoxybenzenesulfonamide (PubChem CID 110788857) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is N-[2-(4-ethoxy-3-methylphenyl)ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(4-ethoxy-3-methylphenyl)ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110788857 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[2-(4-ethoxy-3-methylphenyl)ethyl]-4-methoxybenzenesulfonamide |
| SMILES | CCOc1ccc(CCNS(=O)(=O)c2ccc(OC)cc2)cc1C |
| InChI | InChI=1S/C18H23NO4S/c1-4-23-18-10-5-15(13-14(18)2)11-12-19-24(20,21)17-8-6-16(22-3)7-9-17/h5-10,13,19H,4,11-12H2,1-3H3 |
| InChIKey | VLLPFAXXANQZRD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |