C16H18ClNO4S — CID 113102633
N-[2-(4-chloro-2-methylphenoxy)ethyl]-4-methoxybenzenesulfonamide (PubChem CID 113102633) has the molecular formula C16H18ClNO4S and a molecular weight of 355.84 g/mol. Its IUPAC name is N-[2-(4-chloro-2-methylphenoxy)ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(4-chloro-2-methylphenoxy)ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113102633 |
| Molecular Formula | C16H18ClNO4S |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N-[2-(4-chloro-2-methylphenoxy)ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCOc2ccc(Cl)cc2C)cc1 |
| InChI | InChI=1S/C16H18ClNO4S/c1-12-11-13(17)3-8-16(12)22-10-9-18-23(19,20)15-6-4-14(21-2)5-7-15/h3-8,11,18H,9-10H2,1-2H3 |
| InChIKey | FWJPOXIOEXQMHX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|