C22H31NO4S — CID 3699992
N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-4-(2-methylbutan-2-yl)benzenesulfonamide (PubChem CID 3699992) has the molecular formula C22H31NO4S and a molecular weight of 405.56 g/mol. Its IUPAC name is N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-4-(2-methylbutan-2-yl)benzenesulfonamide.
| Compound Name | N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-4-(2-methylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3699992 |
| Molecular Formula | C22H31NO4S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-4-(2-methylbutan-2-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(CCNS(=O)(=O)c2ccc(C(C)(C)CC)cc2)cc1OC |
| InChI | InChI=1S/C22H31NO4S/c1-6-22(3,4)18-9-11-19(12-10-18)28(24,25)23-15-14-17-8-13-20(27-7-2)21(16-17)26-5/h8-13,16,23H,6-7,14-15H2,1-5H3 |
| InChIKey | QDIWGOPMFLDCCF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |