C22H26N2O5S — CID 3869525
8-ethoxy-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]quinoline-5-sulfonamide (PubChem CID 3869525) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 8-ethoxy-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]quinoline-5-sulfonamide.
| Compound Name | 8-ethoxy-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 3869525 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 8-ethoxy-N-[2-(4-ethoxy-3-methoxyphenyl)ethyl]quinoline-5-sulfonamide |
| SMILES | CCOc1ccc(CCNS(=O)(=O)c2ccc(OCC)c3ncccc23)cc1OC |
| InChI | InChI=1S/C22H26N2O5S/c1-4-28-18-9-8-16(15-20(18)27-3)12-14-24-30(25,26)21-11-10-19(29-5-2)22-17(21)7-6-13-23-22/h6-11,13,15,24H,4-5,12,14H2,1-3H3 |
| InChIKey | GGWXETATDSTIJS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |