C22H22BrN3O6S3 — CID 174393155
(4-bromophenyl)-[2-[4-[(4-methoxyphenyl)carbamothioylsulfamoyl]phenyl]ethyl]sulfamic acid (PubChem CID 174393155) has the molecular formula C22H22BrN3O6S3 and a molecular weight of 600.54 g/mol. Its IUPAC name is (4-bromophenyl)-[2-[4-[(4-methoxyphenyl)carbamothioylsulfamoyl]phenyl]ethyl]sulfamic acid.
| Compound Name | (4-bromophenyl)-[2-[4-[(4-methoxyphenyl)carbamothioylsulfamoyl]phenyl]ethyl]sulfamic acid |
|---|---|
| PubChem CID | 174393155 |
| Molecular Formula | C22H22BrN3O6S3 |
| Molecular Weight | 600.54 g/mol |
| Exact Mass | 598.99 |
| IUPAC Name | (4-bromophenyl)-[2-[4-[(4-methoxyphenyl)carbamothioylsulfamoyl]phenyl]ethyl]sulfamic acid |
| SMILES | COc1ccc(NC(=S)NS(=O)(=O)c2ccc(CCN(c3ccc(Br)cc3)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C22H22BrN3O6S3/c1-32-20-10-6-18(7-11-20)24-22(33)25-34(27,28)21-12-2-16(3-13-21)14-15-26(35(29,30)31)19-8-4-17(23)5-9-19/h2-13H,14-15H2,1H3,(H2,24,25,33)(H,29,30,31) |
| InChIKey | GZACYJCSHZAFFG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|