C17H19BrN2O3S — CID 9120965
4-bromo-N-[(Z)-4-(4-methoxyphenyl)butan-2-ylideneamino]benzenesulfonamide (PubChem CID 9120965) has the molecular formula C17H19BrN2O3S and a molecular weight of 411.32 g/mol. Its IUPAC name is 4-bromo-N-[(Z)-4-(4-methoxyphenyl)butan-2-ylideneamino]benzenesulfonamide.
| Compound Name | 4-bromo-N-[(Z)-4-(4-methoxyphenyl)butan-2-ylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 9120965 |
| Molecular Formula | C17H19BrN2O3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 4-bromo-N-[(Z)-4-(4-methoxyphenyl)butan-2-ylideneamino]benzenesulfonamide |
| SMILES | COc1ccc(CC/C(C)=N\NS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H19BrN2O3S/c1-13(3-4-14-5-9-16(23-2)10-6-14)19-20-24(21,22)17-11-7-15(18)8-12-17/h5-12,20H,3-4H2,1-2H3/b19-13- |
| InChIKey | NDUUQTTXYGBOEI-UYRXBGFRSA-N |
| XLogP | 3.74 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|