C14H17BrN4O3S — CID 40655707
N-[(Z)-1-(4-bromo-1-ethylpyrazol-3-yl)ethylideneamino]-4-methoxybenzenesulfonamide (PubChem CID 40655707) has the molecular formula C14H17BrN4O3S and a molecular weight of 401.29 g/mol. Its IUPAC name is N-[(Z)-1-(4-bromo-1-ethylpyrazol-3-yl)ethylideneamino]-4-methoxybenzenesulfonamide.
| Compound Name | N-[(Z)-1-(4-bromo-1-ethylpyrazol-3-yl)ethylideneamino]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 40655707 |
| Molecular Formula | C14H17BrN4O3S |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | N-[(Z)-1-(4-bromo-1-ethylpyrazol-3-yl)ethylideneamino]-4-methoxybenzenesulfonamide |
| SMILES | CCn1cc(Br)c(/C(C)=N\NS(=O)(=O)c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C14H17BrN4O3S/c1-4-19-9-13(15)14(17-19)10(2)16-18-23(20,21)12-7-5-11(22-3)6-8-12/h5-9,18H,4H2,1-3H3/b16-10- |
| InChIKey | VZVBCBZYMAKZRU-YBEGLDIGSA-N |
| XLogP | 2.38 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|