C16H20Cl2N4O2S2 — CID 155549838
1-[4-(2-aminoethylsulfamoyl)phenyl]-3-[(4-chlorophenyl)methyl]thiourea;hydrochloride (PubChem CID 155549838) has the molecular formula C16H20Cl2N4O2S2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-[(4-chlorophenyl)methyl]thiourea;hydrochloride.
| Compound Name | 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-[(4-chlorophenyl)methyl]thiourea;hydrochloride |
|---|---|
| PubChem CID | 155549838 |
| Molecular Formula | C16H20Cl2N4O2S2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-[(4-chlorophenyl)methyl]thiourea;hydrochloride |
| SMILES | Cl.NCCNS(=O)(=O)c1ccc(NC(=S)NCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H19ClN4O2S2.ClH/c17-13-3-1-12(2-4-13)11-19-16(24)21-14-5-7-15(8-6-14)25(22,23)20-10-9-18;/h1-8,20H,9-11,18H2,(H2,19,21,24);1H |
| InChIKey | OSMLLWBICCFNHI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|