C13H23ClN4O2S2 — CID 155559406
1-[4-(2-aminoethylsulfamoyl)phenyl]-3-tert-butylthiourea;hydrochloride (PubChem CID 155559406) has the molecular formula C13H23ClN4O2S2 and a molecular weight of 366.94 g/mol. Its IUPAC name is 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-tert-butylthiourea;hydrochloride.
| Compound Name | 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-tert-butylthiourea;hydrochloride |
|---|---|
| PubChem CID | 155559406 |
| Molecular Formula | C13H23ClN4O2S2 |
| Molecular Weight | 366.94 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-[4-(2-aminoethylsulfamoyl)phenyl]-3-tert-butylthiourea;hydrochloride |
| SMILES | CC(C)(C)NC(=S)Nc1ccc(S(=O)(=O)NCCN)cc1.Cl |
| InChI | InChI=1S/C13H22N4O2S2.ClH/c1-13(2,3)17-12(20)16-10-4-6-11(7-5-10)21(18,19)15-9-8-14;/h4-7,15H,8-9,14H2,1-3H3,(H2,16,17,20);1H |
| InChIKey | XZVURZKKXSTAMB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.94 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|