C11H17N3O3S2 — CID 169358592
[4-(3-methoxypropylsulfamoyl)phenyl]thiourea (PubChem CID 169358592) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is [4-(3-methoxypropylsulfamoyl)phenyl]thiourea.
| Compound Name | [4-(3-methoxypropylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 169358592 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [4-(3-methoxypropylsulfamoyl)phenyl]thiourea |
| SMILES | COCCCNS(=O)(=O)c1ccc(NC(N)=S)cc1 |
| InChI | InChI=1S/C11H17N3O3S2/c1-17-8-2-7-13-19(15,16)10-5-3-9(4-6-10)14-11(12)18/h3-6,13H,2,7-8H2,1H3,(H3,12,14,18) |
| InChIKey | OTHPQEQPSNUZKS-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|