C16H20N2O4S2 — CID 3160786
N-[4-(3-methoxypropylsulfamoyl)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 3160786) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-[4-(3-methoxypropylsulfamoyl)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-(3-methoxypropylsulfamoyl)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 3160786 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[4-(3-methoxypropylsulfamoyl)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | COCCCNS(=O)(=O)c1ccc(NC(=O)Cc2cccs2)cc1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-22-10-3-9-17-24(20,21)15-7-5-13(6-8-15)18-16(19)12-14-4-2-11-23-14/h2,4-8,11,17H,3,9-10,12H2,1H3,(H,18,19) |
| InChIKey | QADOSVKHCQXDRE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|