C24H25N3O5S — CID 3331259
3-benzamido-N-[4-(3-methoxypropylsulfamoyl)phenyl]benzamide (PubChem CID 3331259) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is 3-benzamido-N-[4-(3-methoxypropylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-benzamido-N-[4-(3-methoxypropylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 3331259 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 3-benzamido-N-[4-(3-methoxypropylsulfamoyl)phenyl]benzamide |
| SMILES | COCCCNS(=O)(=O)c1ccc(NC(=O)c2cccc(NC(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-32-16-6-15-25-33(30,31)22-13-11-20(12-14-22)26-24(29)19-9-5-10-21(17-19)27-23(28)18-7-3-2-4-8-18/h2-5,7-14,17,25H,6,15-16H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | YWMMQZFMOKUIPK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|