C14H17NO4S2 — CID 35299415
4-(2-methoxyethoxy)-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 35299415) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-(2-methoxyethoxy)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35299415 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 4-(2-methoxyethoxy)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C14H17NO4S2/c1-18-8-9-19-12-4-6-14(7-5-12)21(16,17)15-11-13-3-2-10-20-13/h2-7,10,15H,8-9,11H2,1H3 |
| InChIKey | BZIYAOZFYLZJDF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|