C17H22N2O5S — CID 35389739
N-[(2-ethoxy-3-pyridinyl)methyl]-4-(2-methoxyethoxy)benzenesulfonamide (PubChem CID 35389739) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[(2-ethoxy-3-pyridinyl)methyl]-4-(2-methoxyethoxy)benzenesulfonamide.
| Compound Name | N-[(2-ethoxy-3-pyridinyl)methyl]-4-(2-methoxyethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 35389739 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[(2-ethoxy-3-pyridinyl)methyl]-4-(2-methoxyethoxy)benzenesulfonamide |
| SMILES | CCOc1ncccc1CNS(=O)(=O)c1ccc(OCCOC)cc1 |
| InChI | InChI=1S/C17H22N2O5S/c1-3-23-17-14(5-4-10-18-17)13-19-25(20,21)16-8-6-15(7-9-16)24-12-11-22-2/h4-10,19H,3,11-13H2,1-2H3 |
| InChIKey | DCAVBJSAVBRTTH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|