C15H18ClNO3S2 — CID 35202750
3-butoxy-4-chloro-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 35202750) has the molecular formula C15H18ClNO3S2 and a molecular weight of 359.90 g/mol. Its IUPAC name is 3-butoxy-4-chloro-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-butoxy-4-chloro-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 35202750 |
| Molecular Formula | C15H18ClNO3S2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 3-butoxy-4-chloro-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CCCCOc1cc(S(=O)(=O)NCc2cccs2)ccc1Cl |
| InChI | InChI=1S/C15H18ClNO3S2/c1-2-3-8-20-15-10-13(6-7-14(15)16)22(18,19)17-11-12-5-4-9-21-12/h4-7,9-10,17H,2-3,8,11H2,1H3 |
| InChIKey | MUCOWVNYULZJCS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|