C14H23N3O3S2 — CID 142932247
[4-[(5-hydroxy-5-methylhexyl)sulfamoyl]phenyl]thiourea (PubChem CID 142932247) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is [4-[(5-hydroxy-5-methylhexyl)sulfamoyl]phenyl]thiourea.
| Compound Name | [4-[(5-hydroxy-5-methylhexyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 142932247 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | [4-[(5-hydroxy-5-methylhexyl)sulfamoyl]phenyl]thiourea |
| SMILES | CC(C)(O)CCCCNS(=O)(=O)c1ccc(NC(N)=S)cc1 |
| InChI | InChI=1S/C14H23N3O3S2/c1-14(2,18)9-3-4-10-16-22(19,20)12-7-5-11(6-8-12)17-13(15)21/h5-8,16,18H,3-4,9-10H2,1-2H3,(H3,15,17,21) |
| InChIKey | HMKPLQKMWICBNA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|