C13H20N4O4S2 — CID 2205179
N-[4-[(3-methoxypropylcarbamothioylamino)sulfamoyl]phenyl]acetamide (PubChem CID 2205179) has the molecular formula C13H20N4O4S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[4-[(3-methoxypropylcarbamothioylamino)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[(3-methoxypropylcarbamothioylamino)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2205179 |
| Molecular Formula | C13H20N4O4S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[4-[(3-methoxypropylcarbamothioylamino)sulfamoyl]phenyl]acetamide |
| SMILES | COCCCNC(=S)NNS(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C13H20N4O4S2/c1-10(18)15-11-4-6-12(7-5-11)23(19,20)17-16-13(22)14-8-3-9-21-2/h4-7,17H,3,8-9H2,1-2H3,(H,15,18)(H2,14,16,22) |
| InChIKey | NCYLVOHWXMGECJ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|