C24H28F3N3O7S — CID 146062147
1-[4-[(4-acetamidophenyl)sulfonylamino]phenyl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146062147) has the molecular formula C24H28F3N3O7S and a molecular weight of 559.56 g/mol. Its IUPAC name is 1-[4-[(4-acetamidophenyl)sulfonylamino]phenyl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[(4-acetamidophenyl)sulfonylamino]phenyl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062147 |
| Molecular Formula | C24H28F3N3O7S |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 1-[4-[(4-acetamidophenyl)sulfonylamino]phenyl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCCNC(=O)C1(c2ccc(NS(=O)(=O)c3ccc(NC(C)=O)cc3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27N3O5S.C2HF3O2/c1-16(26)24-18-8-10-20(11-9-18)31(28,29)25-19-6-4-17(5-7-19)22(12-13-22)21(27)23-14-3-15-30-2;3-2(4,5)1(6)7/h4-11,25H,3,12-15H2,1-2H3,(H,23,27)(H,24,26);(H,6,7) |
| InChIKey | IVLWMFFFBZERLG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|