C25H31F3N2O5S — CID 146062332
N-butyl-1-[4-[(4-propan-2-ylphenyl)sulfonylamino]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146062332) has the molecular formula C25H31F3N2O5S and a molecular weight of 528.59 g/mol. Its IUPAC name is N-butyl-1-[4-[(4-propan-2-ylphenyl)sulfonylamino]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-1-[4-[(4-propan-2-ylphenyl)sulfonylamino]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062332 |
| Molecular Formula | C25H31F3N2O5S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | N-butyl-1-[4-[(4-propan-2-ylphenyl)sulfonylamino]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)C1(c2ccc(NS(=O)(=O)c3ccc(C(C)C)cc3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H30N2O3S.C2HF3O2/c1-4-5-16-24-22(26)23(14-15-23)19-8-10-20(11-9-19)25-29(27,28)21-12-6-18(7-13-21)17(2)3;3-2(4,5)1(6)7/h6-13,17,25H,4-5,14-16H2,1-3H3,(H,24,26);(H,6,7) |
| InChIKey | HSCBBDRMLBBECE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|