C26H31F3N2O5S — CID 146062335
N-butyl-1-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146062335) has the molecular formula C26H31F3N2O5S and a molecular weight of 540.60 g/mol. Its IUPAC name is N-butyl-1-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-1-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062335 |
| Molecular Formula | C26H31F3N2O5S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | N-butyl-1-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)C1(c2ccc(NS(=O)(=O)c3ccc4c(c3)CCCC4)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H30N2O3S.C2HF3O2/c1-2-3-16-25-23(27)24(14-15-24)20-9-11-21(12-10-20)26-30(28,29)22-13-8-18-6-4-5-7-19(18)17-22;3-2(4,5)1(6)7/h8-13,17,26H,2-7,14-16H2,1H3,(H,25,27);(H,6,7) |
| InChIKey | WSULJHURALLFQO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|