C23H27F3N2O5S — CID 146062340
N-butyl-1-[4-[(3-methylphenyl)sulfonylamino]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146062340) has the molecular formula C23H27F3N2O5S and a molecular weight of 500.54 g/mol. Its IUPAC name is N-butyl-1-[4-[(3-methylphenyl)sulfonylamino]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-1-[4-[(3-methylphenyl)sulfonylamino]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062340 |
| Molecular Formula | C23H27F3N2O5S |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | N-butyl-1-[4-[(3-methylphenyl)sulfonylamino]phenyl]cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)C1(c2ccc(NS(=O)(=O)c3cccc(C)c3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26N2O3S.C2HF3O2/c1-3-4-14-22-20(24)21(12-13-21)17-8-10-18(11-9-17)23-27(25,26)19-7-5-6-16(2)15-19;3-2(4,5)1(6)7/h5-11,15,23H,3-4,12-14H2,1-2H3,(H,22,24);(H,6,7) |
| InChIKey | GFQQFSJASZGUPU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|