C20H22BrF3N2O5S2 — CID 146062328
1-[4-[(5-bromothiophen-2-yl)sulfonylamino]phenyl]-N-butylcyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146062328) has the molecular formula C20H22BrF3N2O5S2 and a molecular weight of 571.44 g/mol. Its IUPAC name is 1-[4-[(5-bromothiophen-2-yl)sulfonylamino]phenyl]-N-butylcyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[(5-bromothiophen-2-yl)sulfonylamino]phenyl]-N-butylcyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062328 |
| Molecular Formula | C20H22BrF3N2O5S2 |
| Molecular Weight | 571.44 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | 1-[4-[(5-bromothiophen-2-yl)sulfonylamino]phenyl]-N-butylcyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)C1(c2ccc(NS(=O)(=O)c3ccc(Br)s3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21BrN2O3S2.C2HF3O2/c1-2-3-12-20-17(22)18(10-11-18)13-4-6-14(7-5-13)21-26(23,24)16-9-8-15(19)25-16;3-2(4,5)1(6)7/h4-9,21H,2-3,10-12H2,1H3,(H,20,22);(H,6,7) |
| InChIKey | JHOWPGIDGFFMEW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|