C22H24BrF3N2O6S — CID 146062143
1-[4-[(4-bromophenyl)sulfonylamino]phenyl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146062143) has the molecular formula C22H24BrF3N2O6S and a molecular weight of 581.41 g/mol. Its IUPAC name is 1-[4-[(4-bromophenyl)sulfonylamino]phenyl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[4-[(4-bromophenyl)sulfonylamino]phenyl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146062143 |
| Molecular Formula | C22H24BrF3N2O6S |
| Molecular Weight | 581.41 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | 1-[4-[(4-bromophenyl)sulfonylamino]phenyl]-N-(3-methoxypropyl)cyclopropane-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCCNC(=O)C1(c2ccc(NS(=O)(=O)c3ccc(Br)cc3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H23BrN2O4S.C2HF3O2/c1-27-14-2-13-22-19(24)20(11-12-20)15-3-7-17(8-4-15)23-28(25,26)18-9-5-16(21)6-10-18;3-2(4,5)1(6)7/h3-10,23H,2,11-14H2,1H3,(H,22,24);(H,6,7) |
| InChIKey | AWSXCNICAOQTRG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|